2,4-Dibromopyridine
- Product Name2,4-Dibromopyridine
- CAS58530-53-3
- CBNumberCB2158125
- MFC5H3Br2N
- MW236.89
- EINECS663-373-4
- MDL NumberMFCD01859720
- MOL File58530-53-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 35-40 °C |
| Boiling point | 238°C(lit.) |
| Density | 2.059±0.06 g/cm3(Predicted) |
| Flash point | >110℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 0.17±0.10(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C5H3Br2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | PCMMSLVJMKQWMQ-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 58530-53-3(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-22 | |||||||||
| Safety Statements | 26-36/37/39-36-37-22 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 1 | |||||||||
| HazardClass | IRRITANT | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
