1,4-Bis(trimethylsilyl)-1,3-butadiyne
- Product Name1,4-Bis(trimethylsilyl)-1,3-butadiyne
- CAS4526-07-2
- CBNumberCB1485017
- MFC10H18Si2
- MW194.42
- EINECS629-258-8
- MDL NumberMFCD00009839
- MOL File4526-07-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 111-113 °C(lit.) |
| Boiling point | 197.7±23.0 °C(Predicted) |
| Density | 0.974 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | >45°C |
| storage temp. | 2-8°C |
| form | solid |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1758268 |
| InChI | InChI=1S/C10H18Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h1-6H3 |
| InChIKey | LBNVCJHJRYJVPK-UHFFFAOYSA-N |
| SMILES | C([Si](C)(C)C)#CC#C[Si](C)(C)C |
| CAS DataBase Reference | 4526-07-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228 | |||||||||
| Precautionary statements | P210 | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 11 | |||||||||
| Safety Statements | 16-22-24/25 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Flam. Sol. 1 | |||||||||
| NFPA 704: |
|
