| Melting point |
240 °C |
| Density |
1.3772 (estimate) |
| bulk density |
290kg/m3 |
| Flash point |
93.3°C |
| storage temp. |
room temp |
| solubility |
Solubility Sparingly soluble in water; freely soluble in ethanol |
| form |
Powder |
| pka |
2.63(at 25℃) |
| color |
Greenish-black or dark blue to gray |
| PH Range |
1.4(colourless)-3.2(pink) |
| Water Solubility |
almost insoluble |
| Sensitive |
Light Sensitive |
| λmax |
528nm |
| Merck |
14,8049 |
| BRN |
3798055 |
| Stability |
Light Sensitive |
| Major Application |
Display device, photoresists, lithographic plates, toner, paints, coating materials, hair dye, treatment of mechanical allodynia, regulation of cell proliferation, diagnostic agents for diseases related with amyloid accumulation, treatment of virus infectiousdiseases, detecting enzyme activity, dental bleaching materials |
| InChI |
1S/C21H23N2.HI/c1-4-23-20(16-12-18-7-5-6-8-21(18)23)15-11-17-9-13-19(14-10-17)22(2)3;/h5-16H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey |
JOLANDVPGMEGLK-UHFFFAOYSA-M |
| SMILES |
[I-].CC[n+]1c(\C=C\c2ccc(cc2)N(C)C)ccc3ccccc13 |
| CAS DataBase Reference |
117-92-0(CAS DataBase Reference) |
| FDA UNII |
Z70656T34N |
| EPA Substance Registry System |
Quinaldine Red (117-92-0) |
| UNSPSC Code |
12352107 |
| NACRES |
NA.47 |