Dimethyl-diphenylpolysiloxane
- Product NameDimethyl-diphenylpolysiloxane
- CAS68083-14-7
- CBNumberCB1330649
- MFC16H22O2Si2
- MW302.51568
- EINECS203-492-7
- MDL NumberMFCD00132673
- MOL File68083-14-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -50 °C |
| Boiling point | >140 °C0.002 mm Hg(lit.) |
| Density | 1.09 g/mL at 20 °C |
| vapor density | >1 (vs air) |
| vapor pressure | <5 mm Hg ( 25 °C) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | no restrictions. |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 0.98 |
| Viscosity | ~200mPa.s(25°C) |
| Water Solubility | Miscible with aliphatic, aromatic hydrocarbons, alcohol and chlorinated hydrocarbons. Immiscible with water, methanol and ethylene glycol. |
| InChI | InChI=1S/C16H22O2Si2/c1-17-19(2,3)18-20(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | ARWRSWALIGRKQA-UHFFFAOYSA-N |
| SMILES | [Si](OC)(C)(C)O[Si](C)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 68083-14-7 |
| EWG's Food Scores | 2 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | VW3146875 | |||||||||
| Autoignition Temperature | 460 °C | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 3910 00 00 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Toxicity | LC50 inhalation in rat: 18gm/m3/1H | |||||||||
| NFPA 704: |
|