Ferric acetylacetonate
- Product NameFerric acetylacetonate
- CAS14024-18-1
- CBNumberCB8677712
- MFC15H21FeO6
- MW353.17
- EINECS237-853-5
- MDL NumberMFCD00000020
- MOL File14024-18-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 180-182 °C (dec.)(lit.) |
| Boiling point | 110°C 2mm |
| bulk density | 500kg/m3 |
| Density | 5.24 g/mL at 25 °C(lit.) |
| vapor pressure | 2.6 hPa (110 °C) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in toluene. |
| form | Powder |
| Specific Gravity | 5.24 |
| color | Red |
| Water Solubility | 2 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4157960 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/3C5H8O2.Fe/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | AQBLLJNPHDIAPN-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[Fe](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H318 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NO8960000 | |||||||||
| F | 21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29420000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 | |||||||||
| Toxicity | LD50 orally in Rabbit: 1872 mg/kg | |||||||||
| NFPA 704: |
|
