1,3,5-Triethylbenzene
- Product Name1,3,5-Triethylbenzene
- CAS102-25-0
- CBNumberCB1110867
- MFC12H18
- MW162.27
- EINECS203-017-3
- MDL NumberMFCD00009261
- MOL File102-25-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -66 °C |
| Boiling point | 215 °C (lit.) |
| Density | 0.862 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 178 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. Soluble in alcohol, ether. |
| BRN | 2039481 |
| Henry's Law Constant | 1.0×10-3 mol/(m3Pa) at 25℃, Plyasunov and Shock (2000) |
| InChI | InChI=1S/C12H18/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | WJYMPXJVHNDZHD-UHFFFAOYSA-N |
| SMILES | C1(CC)=CC(CC)=CC(CC)=C1 |
| CAS DataBase Reference | 102-25-0(CAS DataBase Reference) |
| FDA UNII | 02K328WWZQ |
| EPA Substance Registry System | Benzene, 1,3,5-triethyl- (102-25-0) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H413 | |||||||||
| Precautionary statements | P264-P273-P280-P302+P352-P305+P351+P338-P332+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/38 | |||||||||
| Safety Statements | 26 | |||||||||
| RIDADR | UN 3082 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2902.90.9000 | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 | |||||||||
| NFPA 704: |
|
