(R,R)-2,2'-(Dimethylmethylene)bis(4-phenyl-2-oxazoline)
- Product Name(R,R)-2,2'-(Dimethylmethylene)bis(4-phenyl-2-oxazoline)
- CAS150529-93-4
- CBNumberCB0756813
- MFC21H22N2O2
- MW334.41
- MDL NumberMFCD00192244
- MOL File150529-93-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 56-58 °C(lit.) |
| Boiling point | 468.9±45.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| refractive index | 160 ° (C=1, EtOH) |
| storage temp. | -20°C |
| form | clear liquid |
| pka | 4.85±0.70(Predicted) |
| color | Light yellow to Amber to Dark green |
| optical activity | [α]20/D +160°, c = 1 in ethanol |
| BRN | 4266906 |
| InChI | 1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | JTNVCJCSECAMLD-ROUUACIJSA-N |
| SMILES | CC(C)(C1=N[C@@H](CO1)c2ccccc2)C3=N[C@@H](CO3)c4ccccc4 |
| CAS DataBase Reference | 150529-93-4 |
| FDA UNII | CG7P67W7W0 |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 23/24/25 | |||||||||
| Safety Statements | 26-36-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|
