(R)-1-Cbz-3-pyrrolidinol
- Product Name(R)-1-Cbz-3-pyrrolidinol
- CAS100858-33-1
- CBNumberCB0505444
- MFC12H15NO3
- MW221.25
- MDL NumberMFCD07368258
- MOL File100858-33-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 74-79 °C |
| Boiling point | 370.7±42.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| pka | 14.72±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C12H15NO3/c14-11-6-7-13(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2/t11-/m1/s1 |
| InChIKey | MBLJFGOKYTZKMH-LLVKDONJSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CC[C@@H](O)C1 |
| CAS DataBase Reference | 100858-33-1 |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-36/37/38 | |||||||||
| Safety Statements | 26-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29339900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|