(2R,3R)-2-Amino-3-methylpentanoic acid
- Product Name(2R,3R)-2-Amino-3-methylpentanoic acid
- CAS319-78-8
- CBNumberCB0473220
- MFC6H13NO2
- MW131.17
- EINECS206-269-2
- MDL NumberMFCD00064221
- MOL File319-78-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 272-274 °C |
| alpha | -37 º (c=5, 1 N HCl 24 ºC) |
| Boiling point | 225.8±23.0 °C(Predicted) |
| Density | 1.1720 (estimate) |
| refractive index | -40.5 ° (C=4, 6mol/L HCl) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly), Water (Slightly) |
| pka | 2.57±0.24(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | cell analysis |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m1/s1 |
| InChIKey | AGPKZVBTJJNPAG-RFZPGFLSSA-N |
| SMILES | C(O)(=O)[C@@H]([C@H](C)CC)N |
| CAS DataBase Reference | 319-78-8(CAS DataBase Reference) |
| FDA UNII | V87GJA0G54 |
| EPA Substance Registry System | D-Isoleucine (319-78-8) |
| UNSPSC Code | 12352209 |
Safety
| Hazard Codes | Xn | |||||||||
| Risk Statements | 40 | |||||||||
| Safety Statements | 24/25-36-22 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NR4700000 | |||||||||
| HS Code | 29224995 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Toxicity | rat,LD50,intraperitoneal,6822mg/kg (6822mg/kg),BEHAVIORAL: ALTERED SLEEP TIME (INCLUDING CHANGE IN RIGHTING REFLEX)LUNGS, THORAX, OR RESPIRATION: DYSPNEA,Archives of Biochemistry and Biophysics. Vol. 64, Pg. 319, 1956. | |||||||||
| NFPA 704: |
|
