(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene
- Product Name(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene
- CAS24388-23-6
- CBNumberCB0459079
- MFC12H17BO2
- MW204.07
- MDL NumberMFCD00966985
- MOL File24388-23-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 27-31 °C(lit.) |
| Boiling point | 130°C/20mmHg(lit.) |
| Density | 0.99±0.1 g/cm3(Predicted) |
| Flash point | 225 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to lump |
| color | White to Almost white |
| InChI | 1S/C12H17BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | KKLCYBZPQDOFQK-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2ccccc2 |
| CAS DataBase Reference | 24388-23-6(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
