4-Benzyloxy-2-formylphenylboronic acid
- Product Name4-Benzyloxy-2-formylphenylboronic acid
- CAS139962-97-3
- CBNumberCB0358538
- MFC14H13BO4
- MW256.06
- MDL NumberMFCD02179486
- MOL File139962-97-3.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 490.2±55.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 8.35±0.53(Predicted) |
| color | White to Almost white |
| InChI | 1S/C14H13BO4/c16-9-12-8-13(6-7-14(12)15(17)18)19-10-11-4-2-1-3-5-11/h1-9,17-18H,10H2 |
| InChIKey | XRARNEIDTRHXKN-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(OCc2ccccc2)cc1C=O |
| CAS DataBase Reference | 139962-97-3(CAS DataBase Reference) |
| UNSPSC Code | 12352106 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 36/37/38-43-36 | |||||||||
| Safety Statements | 26-36/37/39-36/37 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 | |||||||||
| NFPA 704: |
|
