(+/-)-2-(6-Methoxy-2-naphthyl)propionic acid
- Product Name(+/-)-2-(6-Methoxy-2-naphthyl)propionic acid
- CAS23981-80-8
- CBNumberCB0239095
- MFC14H14O3
- MW230.26
- EINECS245-969-2
- MDL NumberMFCD00439456
- MOL File23981-80-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 157°C |
| Boiling point | 403.9±20.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 4.84±0.30(Predicted) |
| form | Solid |
| color | White to Light red to Green |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16) |
| InChIKey | CMWTZPSULFXXJA-UHFFFAOYSA-N |
| SMILES | O(C)c1cc2c(cc(cc2)C(C)C(=O)O)cc1 |
| CAS DataBase Reference | 23981-80-8(CAS DataBase Reference) |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P301+P310+P330 | |||||||||
| Risk Statements | 36/37/38-36 | |||||||||
| Safety Statements | 26-36/37/39-36 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29189900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|
