2,4-Dinitrophenylacetic acid
- Product Name2,4-Dinitrophenylacetic acid
- CAS643-43-6
- CBNumberCB0222402
- MFC8H6N2O6
- MW226.14
- EINECS211-398-2
- MDL NumberMFCD00007227
- MOL File643-43-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 169-175 °C (lit.) |
| Boiling point | 367.74°C (rough estimate) |
| Density | 1.6136 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| pka | pK1:3.50 (25°C) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1990798 |
| InChI | 1S/C8H6N2O6/c11-8(12)3-5-1-2-6(9(13)14)4-7(5)10(15)16/h1-2,4H,3H2,(H,11,12) |
| InChIKey | KCNISYPADDTFDO-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 643-43-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetic acid, 2,4-dinitro- (643-43-6) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 1479 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AH2230000 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|