Nornicotine-2,4,5,6-d4 (pyridine-d4)
- Product NameNornicotine-2,4,5,6-d4 (pyridine-d4)
- CAS66148-18-3
- CBNumberCB0163785
- MFC9H8D4N2
- MW152.23
- EINECS804-112-8
- MDL NumberMFCD01074211
- MOL File66148-18-3.mol
- MSDS FileSDS
Chemical Properties
| Flash point | 9℃ |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Methanol: soluble |
| form | A neat oil |
| color | Colorless to light yellow |
| Stability | Light Sensitive |
| Major Application | forensics and toxicology |
| InChI | 1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/i1D,3D,5D,7D |
| InChIKey | MYKUKUCHPMASKF-DNZPNURCSA-N |
| SMILES | N1C(CCC1)c2c(nc(c(c2[2H])[2H])[2H])[2H] |
| CAS DataBase Reference | 66148-18-3 |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
| CAS Number Unlabeled | 5746-86-1 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H301+H311+H331-H370 | |||||||||
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 | |||||||||
| Hazard Codes | F,T | |||||||||
| Risk Statements | 11-23/24/25-39/23/24/25 | |||||||||
| Safety Statements | 7-16-36/37-45 | |||||||||
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | |||||||||
| WGK Germany | 1 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 | |||||||||
| NFPA 704: |
|
