2-Bromobutyryl bromide
- Product Name2-Bromobutyryl bromide
- CAS26074-52-2
- CBNumberCB0126148
- MFC4H6Br2O
- MW229.9
- EINECS247-441-7
- MDL NumberMFCD00000154
- MOL File26074-52-2.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 142-144 °C(lit.) |
| Density | 1.905 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Storage temp. -20°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.905 |
| InChI | InChI=1S/C4H6Br2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| InChIKey | HHKDBXNYWNUHPL-UHFFFAOYSA-N |
| SMILES | C(Br)(=O)C(Br)CC |
| CAS DataBase Reference | 26074-52-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H290-H314-H335 | |||||||||
| Precautionary statements | P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P261-P280-P305+P351+P338-P310 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 19-21 | |||||||||
| HS Code | 2915.90.5050 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 | |||||||||
| NFPA 704: |
|
