Pyrethrine und Pyrethroide
Bezeichnung:Pyrethrine und Pyrethroide
CAS-Nr8003-34-7
Englisch Name:Pyrethrins
CBNumberCB2421513
SummenformelC43H56O8
Molgewicht700.9
MOL-Datei8003-34-7.mol
Synonyma
Pyrethrine und Pyrethroide
Pyrethrumextrakt
Pyrethrine und Pyrethroide physikalisch-chemischer Eigenschaften
| Dichte | 0.84-0.86 g/cm3 |
| Dampfdruck | 2.7×10-3 (pyrethrin I) and 5.3×10-5 (pyrethrin II) Pa |
| Brechungsindex | n |
| Flammpunkt | 75 °C |
| storage temp. | 2-8°C |
| Löslichkeit | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| Wasserlöslichkeit | 0.2 (pyrethrin I) and 9 (pyrethrin II) mg l-1 (ambient temp.) |
| Aggregatzustand | liquid |
| Henry's Law Constant | 1.5×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stabilität | Light Sensitive |
| Major Application | cannabis testing |
| Kosmetik-Inhaltsstoffe Funktionen | NOT REPORTED |
| InChIKey | VXSIXFKKSNGRRO-YWUDCVDHSA-N |
| SMILES | [C@H]1(C(=O)OC2CC(=O)C(C/C=C/C=C)=C2C)C(C)(C)C1/C=C(\C)/C(=O)OC.[C@H]1(C(=O)O[C@H]2CC(=O)C(C/C=C/C=C)=C2C)C(C)(C)C1/C=C(/C)\C |&1:0,27,31,r| |
| EPA chemische Informationen | Pyrethrins (8003-34-7) |
| Kennzeichnung gefährlicher | Xn,N |
| R-Sätze: | 20/21/22-50/53 |
| S-Sätze: | 13-60-61 |
| RIDADR | UN 2810 6.1/PG 3 |
| OEB | B |
| OEL | TWA: 5 mg/m3 |
| WGK Germany | 3 |
| RTECS-Nr. | UR4200000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Speicherklasse | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Flam. Liq. 2 |
| Giftige Stoffe Daten | 8003-34-7(Hazardous Substances Data) |
| Toxizität | The six insecticidal constituents of the extract of the pyrethrum flowers Pyrethrum (Chrysanthemum cinerariaefolium). Pyrethrins I and II are most prominent, existing in the ratio 71:21:7 for pyrethrin (I and II), cinerin (I and II), jasmolin (I and II). Pyrethrins are potent, nonsystemic, contact insec_x0002_ticides, causing rapid paralysis or knockdown and death at a later stage in a variety of insects. They exhibit low vertebrate toxicity with an acute oral LD50 in rats of 1.2 g/kg. The mechanism of action involves modification of nerve membrane Na1 channels. Opening and closing of the Na1 channel is slowed, resulting in increased Na1 permeability and depolarization leading to hyperexcitability. Symptoms in humans include gastrointestinal irritation, nausea, vomiting, diarrhea, numbness of tongue and lips, syncope, hyperexcitability, incoordination, convulsions, muscular paralysis, collapse and death due to respiratory paralysis. Treatment involves gastric lavage, emetics, cathartics, demulcents, artificial respiration if necessary and short-acting barbiturates for convulsions. |
| IDLA | 5,000 mg/m3 |


