
99-27-4
| Name | Dimethyl 5-aminoisophthalate |
| CAS | 99-27-4 |
| EINECS(EC#) | 202-743-8 |
| Molecular Formula | C10H11NO4 |
| MDL Number | MFCD00008435 |
| Molecular Weight | 209.2 |
| MOL File | 99-27-4.mol |
Chemical Properties
| Melting point | 178-181 °C (lit.) |
| Boiling point | 178-180 °C |
| density | 1.248±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in Chloroform. |
| form | powder to crystal |
| pka | 2.31±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 2116565 |
| InChI | InChI=1S/C10H11NO4/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5H,11H2,1-2H3 |
| InChIKey | DEKPYXUDJRABNK-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC(N)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 99-27-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Aminoisophthalic acid, dimethyl ester(99-27-4) |
| EPA Substance Registry System | 99-27-4(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
