
98946-18-0
| Name | tert-Butyl 2,2,2-trichloroacetimidate |
| CAS | 98946-18-0 |
| EINECS(EC#) | 629-631-5 |
| Molecular Formula | C6H10Cl3NO |
| MDL Number | MFCD00237376 |
| Molecular Weight | 218.51 |
| MOL File | 98946-18-0.mol |
Chemical Properties
| Appearance | Clear colorless to pale yellow liquid |
| Melting point | 21 °C(lit.) |
| Boiling point | 65 °C11 mm Hg(lit.) |
| density | 1.222 |
| refractive index | n |
| Fp | 131 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in organic solvents, cyclo hexane. |
| form | Liquid or Low Melting Crystalline Mass |
| pka | 2.49±0.70(Predicted) |
| color | Clear colorless to pale yellow |
| Specific Gravity | 1.222 |
| Sensitive | Moisture Sensitive |
| BRN | 1770049 |
| Stability: | Hygroscopic |
| InChI | 1S/C6H10Cl3NO/c1-5(2,3)11-4(10)6(7,8)9/h10H,1-3H3 |
| InChIKey | CQXDYHPBXDZWBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=N)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 98946-18-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant/Moisture Sensitive |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29252900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

