958293-79-3
| Name | Naproxen-d3 |
| CAS | 958293-79-3 |
| Molecular Formula | C14H11D3O3 |
| MDL Number | MFCD22572922 |
| Molecular Weight | 233.278 |
| MOL File | 958293-79-3.mol |
Chemical Properties
| storage temp. | 4°C, Inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| color | Off-white to light yellow |
| Major Application | clinical environmental forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/i2D3 |
| InChIKey | CMWTZPSULFXXJA-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])Oc1ccc2cc(ccc2c1)C(C)C(O)=O |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |