
947725-04-4
| Name | 4-tert-Butyl-2,6-dimethylphenylsulfur Trifluoride |
| CAS | 947725-04-4 |
| Molecular Formula | C12H17F3S |
| MDL Number | MFCD11858620 |
| Molecular Weight | 250.324 |
| MOL File | 947725-04-4.mol |
Chemical Properties
| Melting point | 60-61℃ (pentane ) |
| Boiling point | 92-93℃ (0.5 Torr) |
| density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | 0-10°C |
| form | crystal |
| color | white to off-white |
| InChI | 1S/C12H17F3S/c1-8-6-10(12(3,4)5)7-9(2)11(8)16(13,14)15/h6-7H,1-5H3 |
| InChIKey | VRTQPEYVMHATOA-UHFFFAOYSA-N |
| SMILES | Cc1cc(cc(C)c1S(F)(F)F)C(C)(C)C |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H301-H314 |
| Precautionary statements | P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P280-P301+P310-P305+P351+P338-P310 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2923 6.1(8) / PGI |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |

