911392-43-3
| Name | (3S,11E)-3,4,5,6,9,10-Hexahydro-14,16-dihydroxy-3-(methyl-<sup>13</sup>C)-1H-2-benzoxacyclotetradecin-1,7(8H)-dione-<sup>13</sup>C<sub>17</sub> |
| CAS | 911392-43-3 |
| EINECS(EC#) | 200-835-2 |
| Molecular Formula | C18H22O5 |
| MDL Number | MFCD16652530 |
| Molecular Weight | 336.526 |
| MOL File | 911392-43-3.mol |
Chemical Properties
| density | 1.169±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Fp | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | MBMQEIFVQACCCH-NMEASMPJSA-N |
| SMILES | [13CH3][13C@H]1[13CH2][13CH2][13CH2][13C](=O)[13CH2][13CH2][13CH2]\[13CH]=[13CH]\[13c]2[13cH][13c](O)[13cH][13c](O)[13c]2[13C](=O)O1 |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |