9003-80-9
| Name | formaldehyde, polymer with n-phenylbenzenamine and2-propanone |
| CAS | 9003-80-9 |
| EINECS(EC#) | 500-011-5 |
| Molecular Formula | C16H19NO2 |
| MDL Number | MFCD00003014 |
| Molecular Weight | 257.328 |
| MOL File | 9003-80-9.mol |
Chemical Properties
| density | 1.16[at 20℃] |
| vapor pressure | 0.095Pa at 20℃ |
| Water Solubility | 276μg/L at 20℃ |
| InChI | InChI=1S/C12H11N.C3H6O.CH2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4;1-2/h1-10,13H;1-2H3;1H2 |
| InChIKey | AXEXTEASNRDWCD-UHFFFAOYSA-N |
| SMILES | C=O.C(=O)(C)C.N(C1C=CC=CC=1)C1C=CC=CC=1 |
| LogP | 6.5 |
| EPA Substance Registry System | Formaldehyde, polymer with N-phenylbenzenamine and 2-propanone (9003-80-9) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H373-H413 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P314-P501 |