9002-12-4
| Name | URICASE |
| CAS | 9002-12-4 |
| EINECS(EC#) | 232-655-5 |
| Molecular Formula | NULL |
| MDL Number | MFCD00082126 |
| Molecular Weight | 567.398 |
| MOL File | 9002-12-4.mol |
Chemical Properties
| storage temp. | −20°C |
| solubility | 5 mg/mL, clear, colorless to very faintly yellow (in enzyme dilution buffer) |
| form | lyophilized powder |
| color | White to off-white |
| biological source | Bacillus sp. (B. fastidiosus) |
| Water Solubility | Hardly soluble in water, slightly soluble in buffer alkaline solution. |
| Merck | 13,9944 |
| Specific Activity | 15-30units/mg protein (biuret) |
| Major Application | detection |
| InChIKey | VPXDHZMLJOJKOX-UHFFFAOYSA-N |
| SMILES | N.OCC1OC(C(O)C1OP(O)(=O)OCC2OC(C(O)C2O)N3C=CC(=O)NC3=O)N4C=CC(=O)NC4=O |
| EPA Substance Registry System | Oxidase, urate (9002-12-4) |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H319-H334-H360FD |
| Precautionary statements | P202-P261-P264-P280-P305+P351+P338-P308+P313 |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | YU7100000 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 35079090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Repr. 1B Resp. Sens. 1 |