90-24-4
| Name | 2'-HYDROXY-4',6'-DIMETHOXYACETOPHENONE |
| CAS | 90-24-4 |
| EINECS(EC#) | 201-978-3 |
| Molecular Formula | C10H12O4 |
| MDL Number | MFCD00017243 |
| Molecular Weight | 196.2 |
| MOL File | 90-24-4.mol |
Chemical Properties
| Melting point | 80-84 °C(lit.) |
| Boiling point | 185°C/20mm |
| density | 1.172±0.06 g/cm3(Predicted) |
| Fp | 185°C/20mm |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in hot methanol. |
| form | powder to crystal |
| pka | 9.41±0.15(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,10067 |
| BRN | 1285013 |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI | 1S/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| InChIKey | FBUBVLUPUDBFME-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(C)=O)c(OC)c1 |
| LogP | 2.933 (est) |
| CAS DataBase Reference | 90-24-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |