873-73-4
| Name | 4-Chlorophenylacetylene |
| CAS | 873-73-4 |
| Molecular Formula | C8H5Cl |
| MDL Number | MFCD00191917 |
| Molecular Weight | 136.58 |
| MOL File | 873-73-4.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 45-47 °C(lit.) |
| Boiling point | 79-82 °C (23 mmHg) |
| density | 1.24 g/cm3(Temp: 50 °C) |
| Fp | 10 °C |
| storage temp. | Keep Cold |
| solubility | Acetone, Chloroform (Slightly), Dichloromethane, DMF, DMSO, Ethanol, Ethyl Acetate) |
| form | Crystalline Mass |
| color | Yellow to pale brown |
| Water Solubility | Insoluble in water. Soluble in acetone, chloroform, dichloromethane, DMF, DMSO, ethanol, ethyl acetate, hexane, methanol,THF and toluene. |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C8H5Cl/c1-2-7-3-5-8(9)6-4-7/h1,3-6H |
| InChIKey | LFZJRTMTKGYJRS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C#C)C=C1 |
| CAS DataBase Reference | 873-73-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-ethynyl-(873-73-4) |
Safety Data
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | 4.1 |
| HazardClass | FLAMMABLE |
| PackingGroup | Ⅱ |
| HS Code | 29039990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |