
865-86-1
| Name | 1,1,2,2-Tetrahydroperfluoro dodecanol |
| CAS | 865-86-1 |
| EINECS(EC#) | 212-748-7 |
| Molecular Formula | C12H5F21O |
| MDL Number | MFCD00039545 |
| Molecular Weight | 564.13 |
| MOL File | 865-86-1.mol |
Chemical Properties
| Melting point | 95 °C |
| Boiling point | 145 °C |
| density | 1.664±0.06 g/cm3(Predicted) |
| refractive index | 1.294 @ 25 °C |
| Fp | 145°C/10mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 14.28±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 2029867 |
| Henry's Law Constant | 1.4×10-4 mol/(m3Pa) at 25℃, Abusallout et al. (2022) |
| Major Application | PFAS testing clinical testing coatings environmental food and beverages |
| InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO |
| CAS DataBase Reference | 865-86-1(CAS DataBase Reference) |
| EPA Substance Registry System | 865-86-1(EPA Substance) |
Safety Data
| Hazard Codes | F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Flammable |
| TSCA | T |
| HS Code | 29055900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |