
86134-26-1
| Name | 2,5‐ bis(triMethylstannyl)th iophene |
| CAS | 86134-26-1 |
| EINECS(EC#) | 810-201-2 |
| Molecular Formula | C10H20SSn2 |
| MDL Number | MFCD01940352 |
| Molecular Weight | 409.75 |
| MOL File | 86134-26-1.mol |
Chemical Properties
| Melting point | 93-102°C |
| Boiling point | 311.5±52.0 °C(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C4H2S.6CH3.2Sn/c1-2-4-5-3-1;;;;;;;;/h1-2H;6*1H3;; |
| InChIKey | KKRPPVXJVZKJON-UHFFFAOYSA-N |
| SMILES | C1([Sn](C)(C)C)SC([Sn](C)(C)C)=CC=1 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H410 |
| Precautionary statements | P260-P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3146 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |

