84268-36-0
| Name | Benzenepropanoic acid, 3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxy- |
| CAS | 84268-36-0 |
| EINECS(EC#) | 630-348-4 |
| Molecular Formula | C19H21N3O3 |
| MDL Number | MFCD12911597 |
| Molecular Weight | 339.39 |
| MOL File | 84268-36-0.mol |
Chemical Properties
| Boiling point | 537.5±60.0 °C(Predicted) |
| density | 1.26±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| form | Powder |
| pka | 4.65±0.10(Predicted) |
| InChI | 1S/C19H21N3O3/c1-19(2,3)13-10-12(8-9-17(23)24)11-16(18(13)25)22-20-14-6-4-5-7-15(14)21-22/h4-7,10-11,25H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | OYGYNUPKLMDVHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCC(O)=O)cc(c1O)-n2nc3ccccc3n2 |
| LogP | 2.75 at 20℃ and pH6.9 |
| Surface tension | 71.5mN/m at 1.002g/L and 20℃ |
| EPA Substance Registry System | Benzenepropanoic acid, 3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxy- (84268-36-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338-P337+P313-P363-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 |