84-60-6
| Name | 2,6-DIHYDROXYANTHRAQUINONE |
| CAS | 84-60-6 |
| EINECS(EC#) | 201-544-3 |
| Molecular Formula | C14H8O4 |
| MDL Number | MFCD00001228 |
| Molecular Weight | 240.21 |
| MOL File | 84-60-6.mol |
Chemical Properties
| Appearance | solid |
| Melting point | >320 °C(lit.) |
| Boiling point | 342.92°C (rough estimate) |
| density | 1.3032 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 6.72±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N |
| SMILES | Oc1ccc2C(=O)c3cc(O)ccc3C(=O)c2c1 |
| LogP | 3.360 (est) |
| CAS DataBase Reference | 84-60-6(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 2,6-dihydroxy- (84-60-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CB6675000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |