83701-22-8
| Name | Minoxidil sulphate |
| CAS | 83701-22-8 |
| EINECS(EC#) | 635-997-7 |
| Molecular Formula | C9H15N5O4S |
| MDL Number | MFCD06248907 |
| Molecular Weight | 289.31 |
| MOL File | 83701-22-8.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 175-180°C |
| density | 1.75±0.1 g/cm3(Predicted) |
| RTECS | UV6260494 |
| storage temp. | −20°C |
| solubility | Acetone (Slightly), DMSO (Slightly) |
| form | White solid. |
| pka | -4.99±0.18(Predicted) |
| color | White to Off-White |
| Usage | A selective ATP-sensitive potassium channel opener. It is the active metabolite of minoxidil and is a potent (IC50=0.14) vascular smooth muscle relaxant |
| Stability: | Light Sensitive - Protect from Light, Store in Freezer |
| InChI | InChI=1S/C9H15N5O4S/c10-7-6-8(13-4-2-1-3-5-13)12-9(11)14(7)18-19(15,16)17/h6,10H,1-5H2,(H2,11,12)(H,15,16,17) |
| InChIKey | AGMYAAIWWVATKU-UHFFFAOYSA-N |
| SMILES | C1(N)N(OS(O)(=O)=O)C(=N)C=C(N2CCCCC2)N=1 |
| CAS DataBase Reference | 83701-22-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,T+ |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |