836-41-9
| Name | N-(4-METHOXYBENZYLIDENE)ANILINE |
| CAS | 836-41-9 |
| EINECS(EC#) | 212-647-8 |
| Molecular Formula | C14H13NO |
| MDL Number | MFCD00025836 |
| Molecular Weight | 211.26 |
| MOL File | 836-41-9.mol |
Chemical Properties
| Melting point | 63-67 °C |
| Boiling point | 339.0±25.0 °C(Predicted) |
| density | 0.99±0.1 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.87±0.30(Predicted) |
| color | White to Light red to Green |
| BRN | 642337 |
| InChI | 1S/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3/b15-11+ |
| InChIKey | MSWPGMRTURVKRJ-RVDMUPIBSA-N |
| SMILES | COc1ccc(cc1)\C=N\c2ccccc2 |
| CAS DataBase Reference | 836-41-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2925.29.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |