835-64-3
| Name | 2-(2-HYDROXYPHENYL)BENZOXAZOLE |
| CAS | 835-64-3 |
| EINECS(EC#) | 212-642-0 |
| Molecular Formula | C13H9NO2 |
| MDL Number | MFCD00005767 |
| Molecular Weight | 211.22 |
| MOL File | 835-64-3.mol |
Chemical Properties
| Appearance | pink to reddish crystalline powder |
| Melting point | 122-124 °C(lit.) |
| Boiling point | 338 °C(lit.) |
| density | 1.1868 (rough estimate) |
| refractive index | 6.71E-13 (355 nm) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Solubility Insoluble in water; soluble in ethanol |
| form | Solid |
| pka | 8.04(at 25℃) |
| color | Light yellow to Brown |
| PH Range | Non0 uorescence (<9.3) to blue-violet 0 uorescence (9.3) |
| Major Application | Electroluminescent devices, sensors, plastic scintillation applications, antitumor agent, antibacterial agent |
| InChI | InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |
| InChIKey | GHGZVWOTJDLREY-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC=C1C1=NC2=CC=CC=C2O1 |
| CAS DataBase Reference | 835-64-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2-(2-benzoxazolyl)- (835-64-3) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SJ7520000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |