829-84-5
| Name | DICYCLOHEXYLPHOSPHINE |
| CAS | 829-84-5 |
| EINECS(EC#) | 212-590-9 |
| Molecular Formula | C12H23P |
| MDL Number | MFCD00014296 |
| Molecular Weight | 198.28 |
| MOL File | 829-84-5.mol |
Chemical Properties
| Melting point | 2°C |
| Boiling point | 129 °C 8 mm Hg |
| density | 0,98 g/cm3 |
| refractive index | n |
| Fp | 2 °C |
| storage temp. | 20-25°C |
| form | liquid |
| color | colorless to light yellow |
| Specific Gravity | 0.98 |
| Hydrolytic Sensitivity | 9: reacts extremely rapidly with atmospheric moisture - may be pyrophoric - glove box or sealed system required |
| Sensitive | air sensitive |
| InChI | InChI=1S/C12H23P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2 |
| InChIKey | HDULBKVLSJEMGN-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)C1CCCCC1 |
| CAS DataBase Reference | 829-84-5 |
| EPA Substance Registry System | Phosphine, dicyclohexyl- (829-84-5) |
Safety Data
| Symbol(GHS) |   GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H225-H250-H301+H311+H331-H319 |
| Precautionary statements | P210-P222-P231-P261-P280 |
| Hazard Codes | F,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2845 4.2/PG 1 |
| WGK Germany | WGK 3 |
| TSCA | No |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Pyr. Liq. 1 |