826-74-4
| Name | 1-VINYLNAPHTHALENE |
| CAS | 826-74-4 |
| EINECS(EC#) | 212-560-5 |
| Molecular Formula | C12H10 |
| MDL Number | MFCD00075766 |
| Molecular Weight | 154.21 |
| MOL File | 826-74-4.mol |
Chemical Properties
| Appearance | Colourless to Pale Green Liquid |
| Melting point | 322 °C |
| Boiling point | 135-138 °C (lit.) |
| density | 1.04 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 101 °C |
| storage temp. | Refrigerator |
| solubility | Soluble in ethyl acetate, hexane and methanol. |
| form | Oil |
| color | Colourless to Orange |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Sensitive | Moisture Sensitive |
| Usage | A precursor of polynuclear aromatic hydrocarbons in tobacco smoke. |
| InChI | InChI=1S/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H,1H2 |
| InChIKey | IGGDKDTUCAWDAN-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 826-74-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H411 |
| Precautionary statements | P261-P264-P273-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 2 |
| HS Code | 29029090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |