80220-63-9
| Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodec-1-yl)phosphonic acid |
| CAS | 80220-63-9 |
| Molecular Formula | C10H6F17O3P |
| MDL Number | MFCD19105612 |
| Molecular Weight | 528.099 |
| MOL File | 80220-63-9.mol |
Chemical Properties
| Melting point | 180.0 to 184.0 °C |
| Boiling point | 300.5±52.0 °C(Predicted) |
| density | 1.727±0.06 g/cm3(Predicted) |
| form | powder to crystal |
| pka | 2.09±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C10H6F17O3P/c11-3(12,1-2-31(28,29)30)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1-2H2,(H2,28,29,30) |
| InChIKey | CETXMCMQEXPPLV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[P](=O)(O)O |
| EPA Substance Registry System | ((Perfluorooctyl)ethyl)phosphonic acid (80220-63-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | WGK 3 |
| HS Code | 2931.39.0030 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |