78782-17-9
| Name | Bis[(pinacolato)boryl]Methane |
| CAS | 78782-17-9 |
| Molecular Formula | C13H26B2O4 |
| MDL Number | MFCD27977747 |
| Molecular Weight | 267.965 |
| MOL File | 78782-17-9.mol |
Chemical Properties
| Melting point | 51.0 to 55.0 °C |
| Boiling point | 272.0±23.0 °C(Predicted) |
| density | 0.97±0.1 g/cm3(Predicted) |
| Fp | >110℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C13H26B2O4/c1-10(2)11(3,4)17-14(16-10)9-15-18-12(5,6)13(7,8)19-15/h9H2,1-8H3 |
| InChIKey | MQYZGGWWHUGYDR-UHFFFAOYSA-N |
| SMILES | C(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| CAS DataBase Reference | 78782-17-9 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![Synthetic Route of Di[(Pinacol)boryl]methane](https://www.chemicalbook.com/NewsImg/2023-10-17/6383313626442388495971485.jpg "Synthetic Route of Di[(Pinacol)boryl]methane")