
777-12-8
| Name | 2-AMINO-6-(TRIFLUOROMETHYL)BENZOTHIAZOLE |
| CAS | 777-12-8 |
| Molecular Formula | C8H5F3N2S |
| MDL Number | MFCD00269597 |
| Molecular Weight | 218.2 |
| MOL File | 777-12-8.mol |
Chemical Properties
| Melting point | 120-124 °C |
| Boiling point | 306.7±52.0 °C(Predicted) |
| density | 1.536±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.52±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| Sensitive | Stench |
| InChI | InChI=1S/C8H5F3N2S/c9-8(10,11)4-1-2-5-6(3-4)14-7(12)13-5/h1-3H,(H2,12,13) |
| InChIKey | WEDYEBJLWMPPOK-UHFFFAOYSA-N |
| SMILES | S1C2=CC(C(F)(F)F)=CC=C2N=C1N |
| CAS DataBase Reference | 777-12-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29342000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |