77-08-7
| Name | 5,5',6,6'-TETRAHYDROXY-3,3,3',3'-TETRAMETHYL-1,1'-SPIROBISINDANE |
| CAS | 77-08-7 |
| EINECS(EC#) | 201-003-1 |
| Molecular Formula | C21H24O4 |
| MDL Number | MFCD00021235 |
| Molecular Weight | 340.41 |
| MOL File | 77-08-7.mol |
Chemical Properties
| Melting point | 300 °C |
| Boiling point | 561.2±50.0 °C(Predicted) |
| density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Slightly soluble in methanol. |
| form | powder to crystal |
| pka | 9.81±0.60(Predicted) |
| color | White to Green to Brown |
| BRN | 2226231 |
| Henry's Law Constant | 1.4×1014 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | InChI=1S/C21H24O4/c1-19(2)9-21(13-7-17(24)15(22)5-11(13)19)10-20(3,4)12-6-16(23)18(25)8-14(12)21/h5-8,22-25H,9-10H2,1-4H3 |
| InChIKey | POFMQEVZKZVAPQ-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(O)C(O)=C3)C(C)(C)C1)C1=C(C=C(O)C(O)=C1)C(C)(C)C2 |
| CAS DataBase Reference | 77-08-7 |
| EPA Substance Registry System | 1,1'-Spirobi[1H-indene]-5,5',6,6'-tetrol, 2,2',3,3'-tetrahydro-3,3,3',3'-tetramethyl- (77-08-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |