
76410-58-7
| Name | 4-BORONO-L-PHENYLALANINE |
| CAS | 76410-58-7 |
| Molecular Formula | C9H12BNO4 |
| MDL Number | MFCD01075172 |
| Molecular Weight | 209.01 |
| MOL File | 76410-58-7.mol |
Chemical Properties
| Appearance | white to off-white powder |
| Melting point | 285-293℃ (dec.) |
| Boiling point | 449.3±55.0 °C(Predicted) |
| density | 1.34±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Aqueous Acid (Slightly) |
| form | Powder |
| pka | 2.20±0.10(Predicted) |
| color | White to off-white |
| BRN | 4458616 |
| InChI | InChI=1S/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | NFIVJOSXJDORSP-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(B(O)O)C=C1)N |
| CAS DataBase Reference | 76410-58-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 1-10 |
| HazardClass | IRRITANT |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
