7498-57-9
| Name | 2-Naphthylacetonitrile |
| CAS | 7498-57-9 |
| EINECS(EC#) | 231-352-5 |
| Molecular Formula | C12H9N |
| MDL Number | MFCD00004122 |
| Molecular Weight | 167.21 |
| MOL File | 7498-57-9.mol |
Chemical Properties
| Appearance | white to light yellow powder |
| Melting point | 82-84 °C (lit.) |
| Boiling point | 303 °C (lit.) |
| density | 1.092 g/mL at 25 °C(lit.) |
| refractive index | 1.5785 (estimate) |
| Fp | 303°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 1862879 |
| InChI | InChI=1S/C12H9N/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9H,7H2 |
| InChIKey | LPCWDVLDJVZIHA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CC#N |
| CAS DataBase Reference | 7498-57-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthylacetonitrile(7498-57-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,C,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |