7321-53-1
| Name | Hexanoicacid,2-ethyl-,iron(3+)salt |
| CAS | 7321-53-1 |
| EINECS(EC#) | 230-794-6 |
| Molecular Formula | C24H45FeO6 |
| MDL Number | MFCD00014006 |
| Molecular Weight | 485.455 |
| MOL File | 7321-53-1.mol |
Chemical Properties
| Boiling point | 400℃[at 101 325 Pa] |
| density | 0.91 |
| Fp | 41℃ |
| storage temp. | Refrigerator |
| form | Liquid |
| Water Solubility | Miscible with chloroform. Immiscible with water. |
| Exposure limits | ACGIH: TWA 100 ppm OSHA: TWA 500 ppm(2900 mg/m3) NIOSH: IDLH 20000 mg/m3; TWA 350 mg/m3; Ceiling 1800 mg/m3 |
| InChI | InChI=1S/3C8H16O2.Fe/c3*1-3-5-6-7(4-2)8(9)10;/h3*7H,3-6H2,1-2H3,(H,9,10);/q;;;+3/p-3 |
| InChIKey | ULUYRVWYCIOFRV-UHFFFAOYSA-K |
| SMILES | [Fe](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| LogP | 5.59 at 20℃ |
| EPA Substance Registry System | Ferric 2-ethylhexanoate (7321-53-1) |
Safety Data
| Symbol(GHS) |   GHS02,GHS08 |
| Hazard statements | H226-H304-H340-H350-H372 |
| Precautionary statements | P210-P260-P301+P310a-P303+P361+P353-P405-P501a |
| RIDADR | UN1993 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | III |