7149-49-7
| Name | NAPHTHALENE-2,3-DICARBOXALDEHYDE |
| CAS | 7149-49-7 |
| Molecular Formula | C12H8O2 |
| MDL Number | MFCD00016618 |
| Molecular Weight | 184.19 |
| MOL File | 7149-49-7.mol |
Chemical Properties
| Appearance | Yellow Fluffy Crystalline Solid |
| Melting point | 131-133 °C(lit.) |
| Boiling point | 380.0±25.0 °C(Predicted) |
| density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| color | White to pale yellow |
| Usage | A useful reagent for the derivatization of primary amines, amino acids and small peptides |
| BRN | 2207267 |
| InChI | InChI=1S/C12H8O2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-8H |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C=O)=C1C=O |
| CAS DataBase Reference | 7149-49-7(CAS DataBase Reference) |
| Storage Precautions | Store under inert gas;Air sensitive |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29122990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |