707-61-9
| Name | 3-METHYL-1-PHENYL-2-PHOSPHOLENE 1-OXIDE |
| CAS | 707-61-9 |
| EINECS(EC#) | 211-901-5 |
| Molecular Formula | C11H13OP |
| MDL Number | MFCD00014518 |
| Molecular Weight | 192.19 |
| MOL File | 707-61-9.mol |
Chemical Properties
| Appearance | white to yellow adhering crystals |
| Melting point | 58-62 °C |
| Boiling point | 150 °C/0.15 mmHg (lit.) |
| density | 1.11±0.1 g/cm3(Predicted) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in polar solvents. |
| form | Lumps |
| color | White to cream |
| Sensitive | Hygroscopic |
| BRN | 609223 |
| InChI | InChI=1S/C11H13OP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | YMKWWHFRGALXLE-UHFFFAOYSA-N |
| SMILES | P1(=O)(C2=CC=CC=C2)C=C(C)CC1 |
| CAS DataBase Reference | 707-61-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Phosphole, 2,3-dihydro-4-methyl-1-phenyl-, 1-oxide (707-61-9) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351-H412 |
| Precautionary statements | P201-P273-P301+P312+P330-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SZ6105100 |
| TSCA | Yes |
| HS Code | 2931499090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 |