
695-96-5
| Name | 2-Bromo-4-chlorophenol |
| CAS | 695-96-5 |
| EINECS(EC#) | 211-785-6 |
| Molecular Formula | C6H4BrClO |
| MDL Number | MFCD00002319 |
| Molecular Weight | 207.45 |
| MOL File | 695-96-5.mol |
Chemical Properties
| Appearance | White to slightly beige low melting solid |
| Melting point | 31-33 °C (lit.) |
| Boiling point | 121-123 °C/10 mmHg (lit.) |
| density | 1.6027 (rough estimate) |
| refractive index | 1.5730 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | powder to lump to clear liquid |
| pka | 7.98±0.18(Predicted) |
| color | White or Colorles to Yellow to Orange |
| BRN | 2042871 |
| InChI | InChI=1S/C6H4BrClO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| InChIKey | ZIYRDJLAJYTELF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 695-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-bromo-4-chloro-(695-96-5) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2020 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
