68737-65-5
| Name | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine |
| CAS | 68737-65-5 |
| Molecular Formula | C8H18N2 |
| MDL Number | MFCD00671527 |
| Molecular Weight | 142.24 |
| MOL File | 68737-65-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 39-44 °C |
| alpha | -145 º (c=4.47 in chloroform) |
| Boiling point | 249.85°C (rough estimate) |
| density | 0.902 |
| refractive index | -140 ° (C=4, CHCl3) |
| Fp | 74 °C |
| storage temp. | 0-6°C |
| form | Low Melting Solid |
| pka | 11.04±0.40(Predicted) |
| color | White to light yellow |
| Optical Rotation | [α]/D -145±5°, c = 4.47 in chloroform |
| InChI | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | JRHPOFJADXHYBR-HTQZYQBOSA-N |
| SMILES | [C@@H]1(NC)CCCC[C@H]1NC |
| CAS DataBase Reference | 68737-65-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3259 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |