68682-01-9
| Name | 2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one |
| CAS | 68682-01-9 |
| Molecular Formula | C20H20O5 |
| MDL Number | MFCD21364780 |
| Molecular Weight | 340.37 |
| MOL File | 68682-01-9.mol |
Chemical Properties
| Melting point | 212-214 °C(Solv: methanol (67-56-1)) |
| Boiling point | 604.2±55.0 °C(Predicted) |
| density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | A solid |
| pka | 8.06±0.40(Predicted) |
| color | White to off-white |
| Stability: | Light Sensitive |
| Major Application | food and beverages |
| InChI | 1S/C20H20O5/c1-11(2)3-8-14-15(22)9-18-19(20(14)24)16(23)10-17(25-18)12-4-6-13(21)7-5-12/h3-7,9,17,21-22,24H,8,10H2,1-2H3/t17-/m0/s1 |
| InChIKey | YHWNASRGLKJRJJ-KRWDZBQOSA-N |
| SMILES | OC1=C(C(CC(C2=CC=C(O)C=C2)O3)=O)C3=CC(O)=C1CC=C(C)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P280-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |