6825-20-3
| Name | 3,6-Dibromocarbazole |
| CAS | 6825-20-3 |
| EINECS(EC#) | 202-205-2 |
| Molecular Formula | C12H7Br2N |
| MDL Number | MFCD00004961 |
| Molecular Weight | 325 |
| MOL File | 6825-20-3.mol |
Chemical Properties
| Appearance | tan to light green powder |
| Melting point | 204-206 °C (lit.) |
| Boiling point | 459.0±25.0 °C(Predicted) |
| density | 1.930±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in benzene, chloroform |
| form | Crystalline Powder |
| pka | 15.47±0.30(Predicted) |
| color | Tan |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H7Br2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H |
| InChIKey | FIHILUSWISKVSR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C2=C1C=CC(Br)=C2 |
| CAS DataBase Reference | 6825-20-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |