67684-64-4
| Name | (+/-)-1-AMINOCYCLOPENTANE-TRANS-1,3-DICARBOXYLIC ACID |
| CAS | 67684-64-4 |
| Molecular Formula | C7H11NO4 |
| MDL Number | MFCD00153759 |
| Molecular Weight | 173.17 |
| MOL File | 67684-64-4.mol |
Chemical Properties
| Boiling point | 352.7±42.0 °C(Predicted) |
| density | 1.452±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: soluble1mg/mL |
| form | solid |
| pka | 2.11±0.40(Predicted) |
| color | white |
| Water Solubility | Soluble to 5 mM in water with gentle warming and to 50 mM in 1eq. NaOH |
| InChI | 1S/C7H11NO4.H2O/c8-7(6(11)12)2-1-4(3-7)5(9)10;/h4H,1-3,8H2,(H,9,10)(H,11,12);1H2/t4-,7+;/m1./s1 |
| InChIKey | AZRMVYVZWAKHMR-RERZVJIGSA-N |
| SMILES | O.N[C@]1(CC[C@H](C1)C(O)=O)C(O)=O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |