
67442-07-3
| Name | 2-CHLORO-N-METHOXY-N-METHYLACETAMIDE |
| CAS | 67442-07-3 |
| Molecular Formula | C4H8ClNO2 |
| MDL Number | MFCD00134232 |
| Molecular Weight | 137.56 |
| MOL File | 67442-07-3.mol |
Chemical Properties
| Appearance | white to light yellow crystals |
| Melting point | 39-41 °C(lit.) |
| Boiling point | 94-95 °C |
| density | 1.178±0.06 g/cm3 (20 ºC 760 Torr) |
| Fp | 220 °F |
| storage temp. | Refrigerator |
| form | Crystals |
| color | White to light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1924015 |
| InChI | InChI=1S/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
| InChIKey | SCOJKGRNQDKFRP-UHFFFAOYSA-N |
| SMILES | C(N(OC)C)(=O)CCl |
| CAS DataBase Reference | 67442-07-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Inactive |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
