6707-12-6
| Name | 5-NORBORNENE-2,2-DIMETHANOL |
| CAS | 6707-12-6 |
| Molecular Formula | C9H14O2 |
| MDL Number | MFCD00167595 |
| Molecular Weight | 154.21 |
| MOL File | 6707-12-6.mol |
Chemical Properties
| Melting point | 111-113 °C(lit.) |
| Boiling point | 252.9±15.0 °C(Predicted) |
| density | 1.150±0.06 g/cm3(Predicted) |
| solubility | very faint turbidity in Methanol |
| form | powder to crystal |
| pka | 14.62±0.10(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C9H14O2/c10-5-9(6-11)4-7-1-2-8(9)3-7/h1-2,7-8,10-11H,3-6H2/t7-,8+/m0/s1 |
| InChIKey | DSHXMENPUICESR-JGVFFNPUSA-N |
| SMILES | OCC1(CO)C[C@@H]2C[C@H]1C=C2 |
| EPA Substance Registry System | Bicyclo[2.2.1]hept- 5-ene-2,2-dimethanol(6707-12-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |